C13H18N2O4S — CID 122132245
N-[(1,1-dioxothian-4-yl)methyl]-2-methyl-4-nitroaniline (PubChem CID 122132245) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-[(1,1-dioxothian-4-yl)methyl]-2-methyl-4-nitroaniline.
| Compound Name | N-[(1,1-dioxothian-4-yl)methyl]-2-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 122132245 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[(1,1-dioxothian-4-yl)methyl]-2-methyl-4-nitroaniline |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H18N2O4S/c1-10-8-12(15(16)17)2-3-13(10)14-9-11-4-6-20(18,19)7-5-11/h2-3,8,11,14H,4-7,9H2,1H3 |
| InChIKey | OUNOOAFABKYGAC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|