C9H15NO2 — CID 10797214
(3aR,7aR)-2-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 10797214) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (3aR,7aR)-2-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | (3aR,7aR)-2-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 10797214 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (3aR,7aR)-2-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | O=[N+]([O-])C1C[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C9H15NO2/c11-10(12)9-5-7-3-1-2-4-8(7)6-9/h7-9H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | HTZRDMABVCNARP-HTQZYQBOSA-N |
| XLogP | 2.23 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|