C11H18N2O4 — CID 132534504
(4aS,7R,7aR)-7,7a-dihydroxy-1,3,4a,7-tetramethyl-5,6-dihydrocyclopenta[d]pyrimidine-2,4-dione (PubChem CID 132534504) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is (4aS,7R,7aR)-7,7a-dihydroxy-1,3,4a,7-tetramethyl-5,6-dihydrocyclopenta[d]pyrimidine-2,4-dione.
| Compound Name | (4aS,7R,7aR)-7,7a-dihydroxy-1,3,4a,7-tetramethyl-5,6-dihydrocyclopenta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 132534504 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (4aS,7R,7aR)-7,7a-dihydroxy-1,3,4a,7-tetramethyl-5,6-dihydrocyclopenta[d]pyrimidine-2,4-dione |
| SMILES | CN1C(=O)N(C)[C@]2(O)[C@](C)(O)CC[C@]2(C)C1=O |
| InChI | InChI=1S/C11H18N2O4/c1-9-5-6-10(2,16)11(9,17)13(4)8(15)12(3)7(9)14/h16-17H,5-6H2,1-4H3/t9-,10-,11-/m1/s1 |
| InChIKey | AUVNCNSMELOVPB-GMTAPVOTSA-N |
| XLogP | -0.25 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |