C9H16N2O2 — CID 134305285
5,5-diethyl-1,3-dimethylimidazolidine-2,4-dione (PubChem CID 134305285) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5,5-diethyl-1,3-dimethylimidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-1,3-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134305285 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5,5-diethyl-1,3-dimethylimidazolidine-2,4-dione |
| SMILES | CCC1(CC)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C9H16N2O2/c1-5-9(6-2)7(12)10(3)8(13)11(9)4/h5-6H2,1-4H3 |
| InChIKey | WAMCABLUVRUUMJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|