C6H10N2O2S — CID 87701231
5-ethyl-3-methyl-5-sulfanylimidazolidine-2,4-dione (PubChem CID 87701231) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is 5-ethyl-3-methyl-5-sulfanylimidazolidine-2,4-dione.
| Compound Name | 5-ethyl-3-methyl-5-sulfanylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87701231 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 5-ethyl-3-methyl-5-sulfanylimidazolidine-2,4-dione |
| SMILES | CCC1(S)NC(=O)N(C)C1=O |
| InChI | InChI=1S/C6H10N2O2S/c1-3-6(11)4(9)8(2)5(10)7-6/h11H,3H2,1-2H3,(H,7,10) |
| InChIKey | WFRWGWYEPYVSLN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|