C12H20N3O3 — CID 59061380
CID 59061380 (PubChem CID 59061380) has the molecular formula C12H20N3O3 and a molecular weight of 254.31 g/mol.
| Compound Name | CID 59061380 |
|---|---|
| PubChem CID | 59061380 |
| Molecular Formula | C12H20N3O3 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | — |
| SMILES | CN1C(=O)NC2(CC(C)(C)N([O])C(C)(C)C2)C1=O |
| InChI | InChI=1S/C12H20N3O3/c1-10(2)6-12(7-11(3,4)15(10)18)8(16)14(5)9(17)13-12/h6-7H2,1-5H3,(H,13,17) |
| InChIKey | JPEXTSOJNVDJME-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|