About Tempone
Tempone (PubChem CID 520789) has the molecular formula C9H16NO2
and a molecular weight of 170.23 g/mol.
Molecular Properties
| Compound Name | Tempone |
| PubChem CID | 520789 |
| Molecular Formula | C9H16NO2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C9H16NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h5-6H2,1-4H3 |
| InChIKey | WSGDRFHJFJRSFY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Tempone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tempone?
The IUPAC name of Tempone (CID 520789) is not available.
What is the SMILES notation for Tempone?
The canonical SMILES for Tempone is CC1(C)CC(=O)CC(C)(C)N1[O].
What is the InChIKey of Tempone?
The InChIKey is WSGDRFHJFJRSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h5-6H2,1-4H3.
What are the key properties of Tempone?
Tempone has a molecular weight of 170.23 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Tempone is sourced from PubChem (CID 520789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).