C9H18NO2+ — CID 22089044
1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-one (PubChem CID 22089044) has the molecular formula C9H18NO2+ and a molecular weight of 172.25 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-one.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 22089044 |
| Molecular Formula | C9H18NO2+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-one |
| SMILES | CC1(C)CC(=O)CC(C)(C)[NH+]1O |
| InChI | InChI=1S/C9H17NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h12H,5-6H2,1-4H3/p+1 |
| InChIKey | KMEUSKGEUADGET-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |