C14H18N2O2 — CID 60585647
3,5-dimethyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 60585647) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3,5-dimethyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3,5-dimethyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60585647 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3,5-dimethyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(C2(C)NC(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-9(2)10-5-7-11(8-6-10)14(3)12(17)16(4)13(18)15-14/h5-9H,1-4H3,(H,15,18) |
| InChIKey | CGHHVTQOBULBBN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|