C14H25FN2O2 — CID 80697160
3,3,6,6-tetraethyl-1-(2-fluoroethyl)piperazine-2,5-dione (PubChem CID 80697160) has the molecular formula C14H25FN2O2 and a molecular weight of 272.36 g/mol. Its IUPAC name is 3,3,6,6-tetraethyl-1-(2-fluoroethyl)piperazine-2,5-dione.
| Compound Name | 3,3,6,6-tetraethyl-1-(2-fluoroethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 80697160 |
| Molecular Formula | C14H25FN2O2 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3,3,6,6-tetraethyl-1-(2-fluoroethyl)piperazine-2,5-dione |
| SMILES | CCC1(CC)NC(=O)C(CC)(CC)N(CCF)C1=O |
| InChI | InChI=1S/C14H25FN2O2/c1-5-13(6-2)12(19)17(10-9-15)14(7-3,8-4)11(18)16-13/h5-10H2,1-4H3,(H,16,18) |
| InChIKey | PVHQOGWWJRAGCA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |