About 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione
6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione (PubChem CID 81110148) has the molecular formula C15H25FN2O2
and a molecular weight of 284.37 g/mol. Its IUPAC name is 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione |
| PubChem CID | 81110148 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione |
| SMILES | CCC1(CC)NC(=O)C(C)(C2CC2)N(CCCF)C1=O |
| InChI | InChI=1S/C15H25FN2O2/c1-4-15(5-2)13(20)18(10-6-9-16)14(3,11-7-8-11)12(19)17-15/h11H,4-10H2,1-3H3,(H,17,19) |
| InChIKey | QIELYUJHKPVOHB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione?
The IUPAC name of 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione (CID 81110148) is 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione.
What is the SMILES notation for 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione?
The canonical SMILES for 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione is CCC1(CC)NC(=O)C(C)(C2CC2)N(CCCF)C1=O.
What is the InChIKey of 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione?
The InChIKey is QIELYUJHKPVOHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25FN2O2/c1-4-15(5-2)13(20)18(10-6-9-16)14(3,11-7-8-11)12(19)17-15/h11H,4-10H2,1-3H3,(H,17,19).
What are the key properties of 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione?
6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione has a molecular weight of 284.37 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-3,3-diethyl-1-(3-fluoropropyl)-6-methylpiperazine-2,5-dione is sourced from PubChem (CID 81110148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).