C16H26N2O2 — CID 64885387
1-butyl-3,6-dicyclopropyl-3,6-dimethylpiperazine-2,5-dione (PubChem CID 64885387) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-butyl-3,6-dicyclopropyl-3,6-dimethylpiperazine-2,5-dione.
| Compound Name | 1-butyl-3,6-dicyclopropyl-3,6-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64885387 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-butyl-3,6-dicyclopropyl-3,6-dimethylpiperazine-2,5-dione |
| SMILES | CCCCN1C(=O)C(C)(C2CC2)NC(=O)C1(C)C1CC1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-5-10-18-14(20)15(2,11-6-7-11)17-13(19)16(18,3)12-8-9-12/h11-12H,4-10H2,1-3H3,(H,17,19) |
| InChIKey | POSBEESJKSSIOA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |