C15H26N2O2 — CID 64887854
1-butyl-3-cyclopropyl-3-methyl-6-propylpiperazine-2,5-dione (PubChem CID 64887854) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-butyl-3-cyclopropyl-3-methyl-6-propylpiperazine-2,5-dione.
| Compound Name | 1-butyl-3-cyclopropyl-3-methyl-6-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64887854 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1-butyl-3-cyclopropyl-3-methyl-6-propylpiperazine-2,5-dione |
| SMILES | CCCCN1C(=O)C(C)(C2CC2)NC(=O)C1CCC |
| InChI | InChI=1S/C15H26N2O2/c1-4-6-10-17-12(7-5-2)13(18)16-15(3,14(17)19)11-8-9-11/h11-12H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | BNOJGXRIFBBBKH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |