C10H20N3O2+ — CID 102238148
2-[(4S)-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl]ethyl-trimethylazanium (PubChem CID 102238148) has the molecular formula C10H20N3O2+ and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[(4S)-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl]ethyl-trimethylazanium.
| Compound Name | 2-[(4S)-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 102238148 |
| Molecular Formula | C10H20N3O2+ |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2-[(4S)-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl]ethyl-trimethylazanium |
| SMILES | CN1C(=O)N[C@@](C)(CC[N+](C)(C)C)C1=O |
| InChI | InChI=1S/C10H19N3O2/c1-10(6-7-13(3,4)5)8(14)12(2)9(15)11-10/h6-7H2,1-5H3/p+1/t10-/m0/s1 |
| InChIKey | MKHUPWLKESLYDD-JTQLQIEISA-O |
| XLogP | 0.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|