C15H26ClN3O3 — CID 174256318
N-chloro-2-methyl-N-[2-methyl-1-(1,3,4-trimethyl-2,5-dioxoimidazolidin-4-yl)propan-2-yl]butanamide (PubChem CID 174256318) has the molecular formula C15H26ClN3O3 and a molecular weight of 331.84 g/mol. Its IUPAC name is N-chloro-2-methyl-N-[2-methyl-1-(1,3,4-trimethyl-2,5-dioxoimidazolidin-4-yl)propan-2-yl]butanamide.
| Compound Name | N-chloro-2-methyl-N-[2-methyl-1-(1,3,4-trimethyl-2,5-dioxoimidazolidin-4-yl)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 174256318 |
| Molecular Formula | C15H26ClN3O3 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-chloro-2-methyl-N-[2-methyl-1-(1,3,4-trimethyl-2,5-dioxoimidazolidin-4-yl)propan-2-yl]butanamide |
| SMILES | CCC(C)C(=O)N(Cl)C(C)(C)CC1(C)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C15H26ClN3O3/c1-8-10(2)11(20)19(16)14(3,4)9-15(5)12(21)17(6)13(22)18(15)7/h10H,8-9H2,1-7H3 |
| InChIKey | HNMCQUVHAGVBMA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|