C17H30N2O3Si — CID 102236035
(4aS,7E,7aS)-4a-tert-butyl-7a-hydroxy-1,3-dimethyl-7-(trimethylsilylmethylidene)-5,6-dihydrocyclopenta[d]pyrimidine-2,4-dione (PubChem CID 102236035) has the molecular formula C17H30N2O3Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (4aS,7E,7aS)-4a-tert-butyl-7a-hydroxy-1,3-dimethyl-7-(trimethylsilylmethylidene)-5,6-dihydrocyclopenta[d]pyrimidine-2,4-dione.
| Compound Name | (4aS,7E,7aS)-4a-tert-butyl-7a-hydroxy-1,3-dimethyl-7-(trimethylsilylmethylidene)-5,6-dihydrocyclopenta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102236035 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (4aS,7E,7aS)-4a-tert-butyl-7a-hydroxy-1,3-dimethyl-7-(trimethylsilylmethylidene)-5,6-dihydrocyclopenta[d]pyrimidine-2,4-dione |
| SMILES | CN1C(=O)N(C)[C@@]2(O)/C(=C/[Si](C)(C)C)CC[C@@]2(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H30N2O3Si/c1-15(2,3)16-10-9-12(11-23(6,7)8)17(16,22)19(5)14(21)18(4)13(16)20/h11,22H,9-10H2,1-8H3/b12-11+/t16-,17+/m0/s1 |
| InChIKey | SRKOLBLCGSWJAW-PUENXVRKSA-N |
| XLogP | 2.83 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|