C13H22O4Si — CID 102051620
dimethyl (2E)-2-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 102051620) has the molecular formula C13H22O4Si and a molecular weight of 270.40 g/mol. Its IUPAC name is dimethyl (2E)-2-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (2E)-2-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102051620 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | dimethyl (2E)-2-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCC/C1=C\[Si](C)(C)C |
| InChI | InChI=1S/C13H22O4Si/c1-16-11(14)13(12(15)17-2)8-6-7-10(13)9-18(3,4)5/h9H,6-8H2,1-5H3/b10-9+ |
| InChIKey | UDQHRXNASTVIMT-MDZDMXLPSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|