C15H24O3Si — CID 53475459
methyl (3E,3aS,7aR)-4-oxo-3-(trimethylsilylmethylidene)-1,2,5,6,7,7a-hexahydroindene-3a-carboxylate (PubChem CID 53475459) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is methyl (3E,3aS,7aR)-4-oxo-3-(trimethylsilylmethylidene)-1,2,5,6,7,7a-hexahydroindene-3a-carboxylate.
| Compound Name | methyl (3E,3aS,7aR)-4-oxo-3-(trimethylsilylmethylidene)-1,2,5,6,7,7a-hexahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 53475459 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | methyl (3E,3aS,7aR)-4-oxo-3-(trimethylsilylmethylidene)-1,2,5,6,7,7a-hexahydroindene-3a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CCC[C@@H]1CC/C2=C\[Si](C)(C)C |
| InChI | InChI=1S/C15H24O3Si/c1-18-14(17)15-11(6-5-7-13(15)16)8-9-12(15)10-19(2,3)4/h10-11H,5-9H2,1-4H3/b12-10+/t11-,15+/m1/s1 |
| InChIKey | LJSOMJXQFCSSGB-HKHDYHSTSA-N |
| XLogP | 3.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|