C21H32O5 — CID 177488816
methyl (1S,3Z,13S)-5-acetyloxy-17-oxobicyclo[11.4.0]heptadec-3-ene-1-carboxylate (PubChem CID 177488816) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is methyl (1S,3Z,13S)-5-acetyloxy-17-oxobicyclo[11.4.0]heptadec-3-ene-1-carboxylate.
| Compound Name | methyl (1S,3Z,13S)-5-acetyloxy-17-oxobicyclo[11.4.0]heptadec-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 177488816 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | methyl (1S,3Z,13S)-5-acetyloxy-17-oxobicyclo[11.4.0]heptadec-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]12C/C=C\C(OC(C)=O)CCCCCCC[C@H]1CCCC2=O |
| InChI | InChI=1S/C21H32O5/c1-16(22)26-18-12-7-5-3-4-6-10-17-11-8-14-19(23)21(17,15-9-13-18)20(24)25-2/h9,13,17-18H,3-8,10-12,14-15H2,1-2H3/b13-9-/t17-,18?,21-/m0/s1 |
| InChIKey | DPNLKCQTLKARMV-WVTQBTKBSA-N |
| XLogP | 4.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|