C21H30N2O9 — CID 163961436
[(2E)-cyclooct-2-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate;(2,5-dioxopyrrolidin-1-yl) acetate;ethane (PubChem CID 163961436) has the molecular formula C21H30N2O9 and a molecular weight of 454.48 g/mol. Its IUPAC name is [(2E)-cyclooct-2-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate;(2,5-dioxopyrrolidin-1-yl) acetate;ethane.
| Compound Name | [(2E)-cyclooct-2-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate;(2,5-dioxopyrrolidin-1-yl) acetate;ethane |
|---|---|
| PubChem CID | 163961436 |
| Molecular Formula | C21H30N2O9 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [(2E)-cyclooct-2-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate;(2,5-dioxopyrrolidin-1-yl) acetate;ethane |
| SMILES | CC.CC(=O)ON1C(=O)CCC1=O.O=C(OC1/C=C\CCCCC1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H17NO5.C6H7NO4.C2H6/c15-11-8-9-12(16)14(11)19-13(17)18-10-6-4-2-1-3-5-7-10;1-4(8)11-7-5(9)2-3-6(7)10;1-2/h4,6,10H,1-3,5,7-9H2;2-3H2,1H3;1-2H3/b6-4-;; |
| InChIKey | SHUONLUSTWJAGC-XFUGJFOESA-N |
| XLogP | 2.73 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|