C15H21NO5 — CID 162737097
(4Z)-bicyclo[6.1.0]non-4-ene;(2,5-dioxopyrrolidin-1-yl) methyl carbonate (PubChem CID 162737097) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is (4Z)-bicyclo[6.1.0]non-4-ene;(2,5-dioxopyrrolidin-1-yl) methyl carbonate.
| Compound Name | (4Z)-bicyclo[6.1.0]non-4-ene;(2,5-dioxopyrrolidin-1-yl) methyl carbonate |
|---|---|
| PubChem CID | 162737097 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (4Z)-bicyclo[6.1.0]non-4-ene;(2,5-dioxopyrrolidin-1-yl) methyl carbonate |
| SMILES | C1=C\CCC2CC2CC/1.COC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H14.C6H7NO5/c1-2-4-6-9-7-8(9)5-3-1;1-11-6(10)12-7-4(8)2-3-5(7)9/h1-2,8-9H,3-7H2;2-3H2,1H3/b2-1-; |
| InChIKey | OLDVCALNENCWBL-ODZAUARKSA-N |
| XLogP | 2.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|