C15H19NO5 — CID 129049237
[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 129049237) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is [(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 129049237 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | O=C(OCC1[C@H]2CC/C=C\CC[C@@H]12)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H19NO5/c17-13-7-8-14(18)16(13)21-15(19)20-9-12-10-5-3-1-2-4-6-11(10)12/h1-2,10-12H,3-9H2/b2-1-/t10-,11+,12? |
| InChIKey | MVZLMHMWYVDJRZ-RFCVITDFSA-N |
| XLogP | 2.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|