C11H10N2O8 — CID 159138690
(2,5-dioxopyrrolidin-1-yl) [2-(2,5-dioxopyrrolidin-1-yl)-2-oxoethyl] carbonate (PubChem CID 159138690) has the molecular formula C11H10N2O8 and a molecular weight of 298.21 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [2-(2,5-dioxopyrrolidin-1-yl)-2-oxoethyl] carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [2-(2,5-dioxopyrrolidin-1-yl)-2-oxoethyl] carbonate |
|---|---|
| PubChem CID | 159138690 |
| Molecular Formula | C11H10N2O8 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [2-(2,5-dioxopyrrolidin-1-yl)-2-oxoethyl] carbonate |
| SMILES | O=C(OCC(=O)N1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H10N2O8/c14-6-1-2-7(15)12(6)10(18)5-20-11(19)21-13-8(16)3-4-9(13)17/h1-5H2 |
| InChIKey | VGAYAFVYLJWAFP-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|