C13H19NO8 — CID 145243926
[(Z)-4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-3-methoxybut-2-en-2-yl] formate;ethane (PubChem CID 145243926) has the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. Its IUPAC name is [(Z)-4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-3-methoxybut-2-en-2-yl] formate;ethane.
| Compound Name | [(Z)-4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-3-methoxybut-2-en-2-yl] formate;ethane |
|---|---|
| PubChem CID | 145243926 |
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(Z)-4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-3-methoxybut-2-en-2-yl] formate;ethane |
| SMILES | CC.CO/C(COC(=O)ON1C(=O)CCC1=O)=C(/C)OC=O |
| InChI | InChI=1S/C11H13NO8.C2H6/c1-7(19-6-13)8(17-2)5-18-11(16)20-12-9(14)3-4-10(12)15;1-2/h6H,3-5H2,1-2H3;1-2H3/b8-7-; |
| InChIKey | CHRWBSIAKKEILY-CFYXSCKTSA-N |
| XLogP | 1.28 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|