C15H15NO5 — CID 23577252
(4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 23577252) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 23577252 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | O=C(OCc1ccc(C2CC2)cc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H15NO5/c17-13-7-8-14(18)16(13)21-15(19)20-9-10-1-3-11(4-2-10)12-5-6-12/h1-4,12H,5-9H2 |
| InChIKey | KWTKSQKNEIUFJP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|