About (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate
(4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 23577252) has the molecular formula C15H15NO5
and a molecular weight of 289.29 g/mol. Its IUPAC name is (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
Molecular Properties
| Compound Name | (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| PubChem CID | 23577252 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | O=C(OCc1ccc(C2CC2)cc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H15NO5/c17-13-7-8-14(18)16(13)21-15(19)20-9-10-1-3-11(4-2-10)12-5-6-12/h1-4,12H,5-9H2 |
| InChIKey | KWTKSQKNEIUFJP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate?
The IUPAC name of (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate (CID 23577252) is (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
What is the SMILES notation for (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate?
The canonical SMILES for (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate is O=C(OCc1ccc(C2CC2)cc1)ON1C(=O)CCC1=O.
What is the InChIKey of (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate?
The InChIKey is KWTKSQKNEIUFJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5/c17-13-7-8-14(18)16(13)21-15(19)20-9-10-1-3-11(4-2-10)12-5-6-12/h1-4,12H,5-9H2.
What are the key properties of (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate?
(4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate has a molecular weight of 289.29 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropylphenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate is sourced from PubChem (CID 23577252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).