C10H11NO8 — CID 138749428
(2,5-dioxopyrrolidin-1-yl) (2-hydroxy-5-methyl-1,3-dioxol-4-yl)methyl carbonate (PubChem CID 138749428) has the molecular formula C10H11NO8 and a molecular weight of 273.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2-hydroxy-5-methyl-1,3-dioxol-4-yl)methyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2-hydroxy-5-methyl-1,3-dioxol-4-yl)methyl carbonate |
|---|---|
| PubChem CID | 138749428 |
| Molecular Formula | C10H11NO8 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2-hydroxy-5-methyl-1,3-dioxol-4-yl)methyl carbonate |
| SMILES | CC1=C(COC(=O)ON2C(=O)CCC2=O)OC(O)O1 |
| InChI | InChI=1S/C10H11NO8/c1-5-6(18-10(15)17-5)4-16-9(14)19-11-7(12)2-3-8(11)13/h10,15H,2-4H2,1H3 |
| InChIKey | MZANDJHKBVOECP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|