C10H10Cl2N2O6 — CID 159499892
dichloromethane;(2,5-dioxopyrrolidin-1-yl) 1,3-oxazol-5-ylmethyl carbonate (PubChem CID 159499892) has the molecular formula C10H10Cl2N2O6 and a molecular weight of 325.10 g/mol. Its IUPAC name is dichloromethane;(2,5-dioxopyrrolidin-1-yl) 1,3-oxazol-5-ylmethyl carbonate.
| Compound Name | dichloromethane;(2,5-dioxopyrrolidin-1-yl) 1,3-oxazol-5-ylmethyl carbonate |
|---|---|
| PubChem CID | 159499892 |
| Molecular Formula | C10H10Cl2N2O6 |
| Molecular Weight | 325.10 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | dichloromethane;(2,5-dioxopyrrolidin-1-yl) 1,3-oxazol-5-ylmethyl carbonate |
| SMILES | ClCCl.O=C(OCc1cnco1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H8N2O6.CH2Cl2/c12-7-1-2-8(13)11(7)17-9(14)15-4-6-3-10-5-16-6;2-1-3/h3,5H,1-2,4H2;1H2 |
| InChIKey | LZGCYJHARFNZBJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.10 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|