C8H6N2O5 — CID 150767969
(2,5-dioxopyrrolidin-1-yl) 1,3-oxazole-5-carboxylate (PubChem CID 150767969) has the molecular formula C8H6N2O5 and a molecular weight of 210.15 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1,3-oxazole-5-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 150767969 |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1,3-oxazole-5-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cnco1 |
| InChI | InChI=1S/C8H6N2O5/c11-6-1-2-7(12)10(6)15-8(13)5-3-9-4-14-5/h3-4H,1-2H2 |
| InChIKey | JZGBKKLAPSINTR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|