C9H9N3O4 — CID 101239643
(2,5-dioxopyrrolidin-1-yl) 1-methylimidazole-4-carboxylate (PubChem CID 101239643) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1-methylimidazole-4-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 101239643 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1-methylimidazole-4-carboxylate |
| SMILES | Cn1cnc(C(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C9H9N3O4/c1-11-4-6(10-5-11)9(15)16-12-7(13)2-3-8(12)14/h4-5H,2-3H2,1H3 |
| InChIKey | SJQPECWVSPTJJU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|