C11H7F3N2O4 — CID 154824711
(2,5-dioxopyrrolidin-1-yl) 6-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 154824711) has the molecular formula C11H7F3N2O4 and a molecular weight of 288.18 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 154824711 |
| Molecular Formula | C11H7F3N2O4 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H7F3N2O4/c12-11(13,14)7-3-1-2-6(15-7)10(19)20-16-8(17)4-5-9(16)18/h1-3H,4-5H2 |
| InChIKey | NAKPITNTOGIRAR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|