C13H6Cl2F3NO2 — CID 2746361
(3,5-dichlorophenyl) 6-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 2746361) has the molecular formula C13H6Cl2F3NO2 and a molecular weight of 336.10 g/mol. Its IUPAC name is (3,5-dichlorophenyl) 6-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | (3,5-dichlorophenyl) 6-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 2746361 |
| Molecular Formula | C13H6Cl2F3NO2 |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | (3,5-dichlorophenyl) 6-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | O=C(Oc1cc(Cl)cc(Cl)c1)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H6Cl2F3NO2/c14-7-4-8(15)6-9(5-7)21-12(20)10-2-1-3-11(19-10)13(16,17)18/h1-6H |
| InChIKey | SXLPRAXFKCIXQY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|