C17H9Cl4NO2S — CID 2743933
(3,5-dichlorophenyl) 2-[(2,6-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 2743933) has the molecular formula C17H9Cl4NO2S and a molecular weight of 433.14 g/mol. Its IUPAC name is (3,5-dichlorophenyl) 2-[(2,6-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | (3,5-dichlorophenyl) 2-[(2,6-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 2743933 |
| Molecular Formula | C17H9Cl4NO2S |
| Molecular Weight | 433.14 g/mol |
| Exact Mass | 430.91 |
| IUPAC Name | (3,5-dichlorophenyl) 2-[(2,6-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | O=C(Oc1cc(Cl)cc(Cl)c1)c1csc(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C17H9Cl4NO2S/c18-9-4-10(19)6-11(5-9)24-17(23)15-8-25-16(22-15)7-12-13(20)2-1-3-14(12)21/h1-6,8H,7H2 |
| InChIKey | MFIKIJZHMSOPKG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.14 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|