C17H10ClN3O4S — CID 2821822
(4-chlorophenyl) 2-(2,1,3-benzoxadiazol-5-yloxymethyl)-1,3-thiazole-4-carboxylate (PubChem CID 2821822) has the molecular formula C17H10ClN3O4S and a molecular weight of 387.80 g/mol. Its IUPAC name is (4-chlorophenyl) 2-(2,1,3-benzoxadiazol-5-yloxymethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | (4-chlorophenyl) 2-(2,1,3-benzoxadiazol-5-yloxymethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 2821822 |
| Molecular Formula | C17H10ClN3O4S |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | (4-chlorophenyl) 2-(2,1,3-benzoxadiazol-5-yloxymethyl)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1)c1csc(COc2ccc3nonc3c2)n1 |
| InChI | InChI=1S/C17H10ClN3O4S/c18-10-1-3-11(4-2-10)24-17(22)15-9-26-16(19-15)8-23-12-5-6-13-14(7-12)21-25-20-13/h1-7,9H,8H2 |
| InChIKey | FECGQTRAXILVMX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|