C18H10Cl4N2O2S — CID 2815869
[(2,6-dichlorophenyl)methylideneamino] 2-[(2,6-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 2815869) has the molecular formula C18H10Cl4N2O2S and a molecular weight of 460.17 g/mol. Its IUPAC name is [(2,6-dichlorophenyl)methylideneamino] 2-[(2,6-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | [(2,6-dichlorophenyl)methylideneamino] 2-[(2,6-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 2815869 |
| Molecular Formula | C18H10Cl4N2O2S |
| Molecular Weight | 460.17 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | [(2,6-dichlorophenyl)methylideneamino] 2-[(2,6-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | O=C(ON=Cc1c(Cl)cccc1Cl)c1csc(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C18H10Cl4N2O2S/c19-12-3-1-4-13(20)10(12)7-17-24-16(9-27-17)18(25)26-23-8-11-14(21)5-2-6-15(11)22/h1-6,8-9H,7H2 |
| InChIKey | BHZAFHRVVDIGAS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.17 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|