C9H7Cl2NO2 — CID 165348151
[(E)-(2,6-dichlorophenyl)methylideneamino] acetate (PubChem CID 165348151) has the molecular formula C9H7Cl2NO2 and a molecular weight of 232.07 g/mol. Its IUPAC name is [(E)-(2,6-dichlorophenyl)methylideneamino] acetate.
| Compound Name | [(E)-(2,6-dichlorophenyl)methylideneamino] acetate |
|---|---|
| PubChem CID | 165348151 |
| Molecular Formula | C9H7Cl2NO2 |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | [(E)-(2,6-dichlorophenyl)methylideneamino] acetate |
| SMILES | CC(=O)O/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H7Cl2NO2/c1-6(13)14-12-5-7-8(10)3-2-4-9(7)11/h2-5H,1H3/b12-5+ |
| InChIKey | XMNDQSMRIMRKKX-LFYBBSHMSA-N |
| XLogP | 2.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|