C14H9Cl2NO3 — CID 11174345
4-[(E)-(2,6-dichlorophenyl)methylideneamino]oxybenzoic acid (PubChem CID 11174345) has the molecular formula C14H9Cl2NO3 and a molecular weight of 310.14 g/mol. Its IUPAC name is 4-[(E)-(2,6-dichlorophenyl)methylideneamino]oxybenzoic acid.
| Compound Name | 4-[(E)-(2,6-dichlorophenyl)methylideneamino]oxybenzoic acid |
|---|---|
| PubChem CID | 11174345 |
| Molecular Formula | C14H9Cl2NO3 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 4-[(E)-(2,6-dichlorophenyl)methylideneamino]oxybenzoic acid |
| SMILES | O=C(O)c1ccc(O/N=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C14H9Cl2NO3/c15-12-2-1-3-13(16)11(12)8-17-20-10-6-4-9(5-7-10)14(18)19/h1-8H,(H,18,19)/b17-8+ |
| InChIKey | RRBBQEQCXJDROT-CAOOACKPSA-N |
| XLogP | 4.10 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|