C11H10Cl2N2O5 — CID 54547211
2-[[2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl]amino]oxyacetic acid (PubChem CID 54547211) has the molecular formula C11H10Cl2N2O5 and a molecular weight of 321.12 g/mol. Its IUPAC name is 2-[[2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl]amino]oxyacetic acid.
| Compound Name | 2-[[2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 54547211 |
| Molecular Formula | C11H10Cl2N2O5 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-[[2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl]amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)CON=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O5/c12-8-2-1-3-9(13)7(8)4-14-19-5-10(16)15-20-6-11(17)18/h1-4H,5-6H2,(H,15,16)(H,17,18) |
| InChIKey | ZHJAAQUQDSQGJK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|