About 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine
2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine (PubChem CID 88522933) has the molecular formula C9H10Cl2N2O
and a molecular weight of 233.10 g/mol. Its IUPAC name is 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine.
Molecular Properties
| Compound Name | 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine |
| PubChem CID | 88522933 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine |
| SMILES | NCCO/N=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O/c10-8-2-1-3-9(11)7(8)6-13-14-5-4-12/h1-3,6H,4-5,12H2/b13-6- |
| InChIKey | PITDHHCIYKPUQM-MLPAPPSSSA-N |
| XLogP | 2.30 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine?
The IUPAC name of 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine (CID 88522933) is 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine.
What is the SMILES notation for 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine?
The canonical SMILES for 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine is NCCO/N=C\c1c(Cl)cccc1Cl.
What is the InChIKey of 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine?
The InChIKey is PITDHHCIYKPUQM-MLPAPPSSSA-N. The full InChI is InChI=1S/C9H10Cl2N2O/c10-8-2-1-3-9(11)7(8)6-13-14-5-4-12/h1-3,6H,4-5,12H2/b13-6-.
What are the key properties of 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine?
2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine has a molecular weight of 233.10 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxyethanamine is sourced from PubChem (CID 88522933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).