C9H9Cl2NO — CID 56981300
1-[(2,6-dichlorophenyl)methylideneamino]ethanol (PubChem CID 56981300) has the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methylideneamino]ethanol.
| Compound Name | 1-[(2,6-dichlorophenyl)methylideneamino]ethanol |
|---|---|
| PubChem CID | 56981300 |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methylideneamino]ethanol |
| SMILES | CC(O)N=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2NO/c1-6(13)12-5-7-8(10)3-2-4-9(7)11/h2-6,13H,1H3 |
| InChIKey | MHBOWTCYNICBRW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|