C17H23Cl2N — CID 175609254
1-(2,6-dichlorophenyl)-N-(3,7-dimethyloct-1-en-3-yl)methanimine (PubChem CID 175609254) has the molecular formula C17H23Cl2N and a molecular weight of 312.28 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-(3,7-dimethyloct-1-en-3-yl)methanimine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-(3,7-dimethyloct-1-en-3-yl)methanimine |
|---|---|
| PubChem CID | 175609254 |
| Molecular Formula | C17H23Cl2N |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-(3,7-dimethyloct-1-en-3-yl)methanimine |
| SMILES | C=CC(C)(CCCC(C)C)/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H23Cl2N/c1-5-17(4,11-7-8-13(2)3)20-12-14-15(18)9-6-10-16(14)19/h5-6,9-10,12-13H,1,7-8,11H2,2-4H3/b20-12+ |
| InChIKey | VDPMFOKBADCYBT-UDWIEESQSA-N |
| XLogP | 6.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|