C14H21ClN2S — CID 113287503
2-chloro-6-(5-methylhexylamino)benzenecarbothioamide (PubChem CID 113287503) has the molecular formula C14H21ClN2S and a molecular weight of 284.86 g/mol. Its IUPAC name is 2-chloro-6-(5-methylhexylamino)benzenecarbothioamide.
| Compound Name | 2-chloro-6-(5-methylhexylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 113287503 |
| Molecular Formula | C14H21ClN2S |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-chloro-6-(5-methylhexylamino)benzenecarbothioamide |
| SMILES | CC(C)CCCCNc1cccc(Cl)c1C(N)=S |
| InChI | InChI=1S/C14H21ClN2S/c1-10(2)6-3-4-9-17-12-8-5-7-11(15)13(12)14(16)18/h5,7-8,10,17H,3-4,6,9H2,1-2H3,(H2,16,18) |
| InChIKey | OAXQBZLOBOCDTH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|