C10H12ClN3O2S — CID 83204135
2-(2-carbamothioyl-3-chloroanilino)ethyl carbamate (PubChem CID 83204135) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is 2-(2-carbamothioyl-3-chloroanilino)ethyl carbamate.
| Compound Name | 2-(2-carbamothioyl-3-chloroanilino)ethyl carbamate |
|---|---|
| PubChem CID | 83204135 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-(2-carbamothioyl-3-chloroanilino)ethyl carbamate |
| SMILES | NC(=O)OCCNc1cccc(Cl)c1C(N)=S |
| InChI | InChI=1S/C10H12ClN3O2S/c11-6-2-1-3-7(8(6)9(12)17)14-4-5-16-10(13)15/h1-3,14H,4-5H2,(H2,12,17)(H2,13,15) |
| InChIKey | UGFFIFDNQFHAQZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|