C17H24FN — CID 175609255
N-(3,7-dimethyloct-1-en-3-yl)-1-(2-fluorophenyl)methanimine (PubChem CID 175609255) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is N-(3,7-dimethyloct-1-en-3-yl)-1-(2-fluorophenyl)methanimine.
| Compound Name | N-(3,7-dimethyloct-1-en-3-yl)-1-(2-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 175609255 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | N-(3,7-dimethyloct-1-en-3-yl)-1-(2-fluorophenyl)methanimine |
| SMILES | C=CC(C)(CCCC(C)C)/N=C/c1ccccc1F |
| InChI | InChI=1S/C17H24FN/c1-5-17(4,12-8-9-14(2)3)19-13-15-10-6-7-11-16(15)18/h5-7,10-11,13-14H,1,8-9,12H2,2-4H3/b19-13+ |
| InChIKey | RSPHHFOGYDDNAF-CPNJWEJPSA-N |
| XLogP | 5.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|