C17H24BrNO — CID 175463116
1-(4-bromophenyl)-N-(3,7-dimethyloct-1-en-3-yloxy)methanimine (PubChem CID 175463116) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-(3,7-dimethyloct-1-en-3-yloxy)methanimine.
| Compound Name | 1-(4-bromophenyl)-N-(3,7-dimethyloct-1-en-3-yloxy)methanimine |
|---|---|
| PubChem CID | 175463116 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-(4-bromophenyl)-N-(3,7-dimethyloct-1-en-3-yloxy)methanimine |
| SMILES | C=CC(C)(CCCC(C)C)ON=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H24BrNO/c1-5-17(4,12-6-7-14(2)3)20-19-13-15-8-10-16(18)11-9-15/h5,8-11,13-14H,1,6-7,12H2,2-4H3 |
| InChIKey | YBTHDPZMXZJFNB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|