C9H10BrN3O2 — CID 23004809
2-[(E)-(4-bromophenyl)methylideneamino]oxyacetohydrazide (PubChem CID 23004809) has the molecular formula C9H10BrN3O2 and a molecular weight of 272.10 g/mol. Its IUPAC name is 2-[(E)-(4-bromophenyl)methylideneamino]oxyacetohydrazide.
| Compound Name | 2-[(E)-(4-bromophenyl)methylideneamino]oxyacetohydrazide |
|---|---|
| PubChem CID | 23004809 |
| Molecular Formula | C9H10BrN3O2 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-[(E)-(4-bromophenyl)methylideneamino]oxyacetohydrazide |
| SMILES | NNC(=O)CO/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H10BrN3O2/c10-8-3-1-7(2-4-8)5-12-15-6-9(14)13-11/h1-5H,6,11H2,(H,13,14)/b12-5+ |
| InChIKey | JJMXYTCMPOLUPT-LFYBBSHMSA-N |
| XLogP | 0.79 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|