C16H23Cl2NO — CID 175463115
2,6-dichloro-N-(3,7-dimethyloct-1-en-3-yloxy)aniline (PubChem CID 175463115) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is 2,6-dichloro-N-(3,7-dimethyloct-1-en-3-yloxy)aniline.
| Compound Name | 2,6-dichloro-N-(3,7-dimethyloct-1-en-3-yloxy)aniline |
|---|---|
| PubChem CID | 175463115 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2,6-dichloro-N-(3,7-dimethyloct-1-en-3-yloxy)aniline |
| SMILES | C=CC(C)(CCCC(C)C)ONc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H23Cl2NO/c1-5-16(4,11-7-8-12(2)3)20-19-15-13(17)9-6-10-14(15)18/h5-6,9-10,12,19H,1,7-8,11H2,2-4H3 |
| InChIKey | MEAFQSLPWBRYMC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|