C9H9Cl2N3OS — CID 175215501
S-[[(E)-(2,6-dichlorophenyl)methylideneamino]-methylamino] carbamothioate (PubChem CID 175215501) has the molecular formula C9H9Cl2N3OS and a molecular weight of 278.16 g/mol. Its IUPAC name is S-[[(E)-(2,6-dichlorophenyl)methylideneamino]-methylamino] carbamothioate.
| Compound Name | S-[[(E)-(2,6-dichlorophenyl)methylideneamino]-methylamino] carbamothioate |
|---|---|
| PubChem CID | 175215501 |
| Molecular Formula | C9H9Cl2N3OS |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | S-[[(E)-(2,6-dichlorophenyl)methylideneamino]-methylamino] carbamothioate |
| SMILES | CN(/N=C/c1c(Cl)cccc1Cl)SC(N)=O |
| InChI | InChI=1S/C9H9Cl2N3OS/c1-14(16-9(12)15)13-5-6-7(10)3-2-4-8(6)11/h2-5H,1H3,(H2,12,15)/b13-5+ |
| InChIKey | GKAXWZWKAIMDKJ-WLRTZDKTSA-N |
| XLogP | 2.99 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|