C14H12Cl2N2 — CID 7584047
N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-methylaniline (PubChem CID 7584047) has the molecular formula C14H12Cl2N2 and a molecular weight of 279.17 g/mol. Its IUPAC name is N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-methylaniline.
| Compound Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-methylaniline |
|---|---|
| PubChem CID | 7584047 |
| Molecular Formula | C14H12Cl2N2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-methylaniline |
| SMILES | CN(/N=C\c1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H12Cl2N2/c1-18(11-6-3-2-4-7-11)17-10-12-13(15)8-5-9-14(12)16/h2-10H,1H3/b17-10- |
| InChIKey | STTOZZKCPLZYPE-YVLHZVERSA-N |
| XLogP | 4.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|