C11H10ClF3N4O — CID 146217334
N-carbamimidoyl-N-[(E)-[2-chloro-6-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 146217334) has the molecular formula C11H10ClF3N4O and a molecular weight of 306.68 g/mol. Its IUPAC name is N-carbamimidoyl-N-[(E)-[2-chloro-6-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | N-carbamimidoyl-N-[(E)-[2-chloro-6-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 146217334 |
| Molecular Formula | C11H10ClF3N4O |
| Molecular Weight | 306.68 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N-carbamimidoyl-N-[(E)-[2-chloro-6-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | [H]/N=C(\N)N(/N=C/c1c(Cl)cccc1C(F)(F)F)C(C)=O |
| InChI | InChI=1S/C11H10ClF3N4O/c1-6(20)19(10(16)17)18-5-7-8(11(13,14)15)3-2-4-9(7)12/h2-5H,1H3,(H3,16,17)/b18-5+ |
| InChIKey | OCZXCDGBZDWBJJ-BLLMUTORSA-N |
| XLogP | 2.43 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.68 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|