C12H16ClN3O2 — CID 158239944
acetic acid;2-[(2-chloro-6-methylphenyl)methylideneamino]ethanimidamide (PubChem CID 158239944) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is acetic acid;2-[(2-chloro-6-methylphenyl)methylideneamino]ethanimidamide.
| Compound Name | acetic acid;2-[(2-chloro-6-methylphenyl)methylideneamino]ethanimidamide |
|---|---|
| PubChem CID | 158239944 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | acetic acid;2-[(2-chloro-6-methylphenyl)methylideneamino]ethanimidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)C/N=C/c1c(C)cccc1Cl |
| InChI | InChI=1S/C10H12ClN3.C2H4O2/c1-7-3-2-4-9(11)8(7)5-14-6-10(12)13;1-2(3)4/h2-5H,6H2,1H3,(H3,12,13);1H3,(H,3,4)/b14-5+; |
| InChIKey | OVLWOGBZOYCKED-OCSIRBNJSA-N |
| XLogP | 2.09 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|